About 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone
1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone (PubChem CID 11508484) has the molecular formula C20H27FN2O2
and a molecular weight of 346.45 g/mol. Its IUPAC name is 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone |
| PubChem CID | 11508484 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone |
| SMILES | CC(=O)N1CC2(CCN(CC3CCCOC3)CC2)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H27FN2O2/c1-15(24)23-14-20(18-11-17(21)4-5-19(18)23)6-8-22(9-7-20)12-16-3-2-10-25-13-16/h4-5,11,16H,2-3,6-10,12-14H2,1H3 |
| InChIKey | CGPSWHPWOUHYMD-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone?
The IUPAC name of 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone (CID 11508484) is 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone.
What is the SMILES notation for 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone?
The canonical SMILES for 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone is CC(=O)N1CC2(CCN(CC3CCCOC3)CC2)c2cc(F)ccc21.
What is the InChIKey of 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone?
The InChIKey is CGPSWHPWOUHYMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H27FN2O2/c1-15(24)23-14-20(18-11-17(21)4-5-19(18)23)6-8-22(9-7-20)12-16-3-2-10-25-13-16/h4-5,11,16H,2-3,6-10,12-14H2,1H3.
What are the key properties of 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone?
1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone has a molecular weight of 346.45 g/mol, XLogP of 2.95, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-fluoro-1'-(oxan-3-ylmethyl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethanone is sourced from PubChem (CID 11508484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).