C8H14O3S — CID 115094511
[2-(thiolan-2-yl)-1,3-dioxolan-4-yl]methanol (PubChem CID 115094511) has the molecular formula C8H14O3S and a molecular weight of 190.26 g/mol. Its IUPAC name is [2-(thiolan-2-yl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(thiolan-2-yl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 115094511 |
| Molecular Formula | C8H14O3S |
| Molecular Weight | 190.26 g/mol |
| Exact Mass | 190.07 |
| IUPAC Name | [2-(thiolan-2-yl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(C2CCCS2)O1 |
| InChI | InChI=1S/C8H14O3S/c9-4-6-5-10-8(11-6)7-2-1-3-12-7/h6-9H,1-5H2 |
| InChIKey | PQCDABULNXOYJM-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |