About 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid
2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid (PubChem CID 115096444) has the molecular formula C10H11NO2S
and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid.
Analyze 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid (CID 115096444) is 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid is CC1CNc2cccc(C(=O)O)c2S1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The InChIKey is HFHPECUMLDERDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-6-5-11-8-4-2-3-7(10(12)13)9(8)14-6/h2-4,6,11H,5H2,1H3,(H,12,13).
What are the key properties of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid has a molecular weight of 209.27 g/mol, XLogP of 2.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid is sourced from PubChem (CID 115096444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).