2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid

C10H11NO2S — CID 115096444

IUPAC2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid
SMILESCC1CNc2cccc(C(=O)O)c2S1
InChIInChI=1S/C10H11NO2S/c1-6-5-11-8-4-2-3-7(10(12)13)9(8)14-6/h2-4,6,11H,5H2,1H3,(H,12,13)
InChIKeyHFHPECUMLDERDK-UHFFFAOYSA-N
MW209.27 g/mol
LogP2.29
Rot. Bonds1

About 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid

2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid (PubChem CID 115096444) has the molecular formula C10H11NO2S and a molecular weight of 209.27 g/mol. Its IUPAC name is 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid.

Molecular Properties

Compound Name2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid
PubChem CID115096444
Molecular FormulaC10H11NO2S
Molecular Weight209.27 g/mol
Exact Mass209.05
IUPAC Name2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid
SMILESCC1CNc2cccc(C(=O)O)c2S1
InChIInChI=1S/C10H11NO2S/c1-6-5-11-8-4-2-3-7(10(12)13)9(8)14-6/h2-4,6,11H,5H2,1H3,(H,12,13)
InChIKeyHFHPECUMLDERDK-UHFFFAOYSA-N
XLogP2.29
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500209.27
LogP ≤ 52.29
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The IUPAC name of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid (CID 115096444) is 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid.
What is the SMILES notation for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The canonical SMILES for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid is CC1CNc2cccc(C(=O)O)c2S1.
What is the InChIKey of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
The InChIKey is HFHPECUMLDERDK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11NO2S/c1-6-5-11-8-4-2-3-7(10(12)13)9(8)14-6/h2-4,6,11H,5H2,1H3,(H,12,13).
What are the key properties of 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid?
2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid has a molecular weight of 209.27 g/mol, XLogP of 2.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-3,4-dihydro-2H-1,4-benzothiazine-8-carboxylic acid is sourced from PubChem (CID 115096444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).