4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid

C10H9NO3S — CID 83822997

IUPAC4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid
SMILESO=C1CCSc2c(cccc2C(=O)O)N1
InChIInChI=1S/C10H9NO3S/c12-8-4-5-15-9-6(10(13)14)2-1-3-7(9)11-8/h1-3H,4-5H2,(H,11,12)(H,13,14)
InChIKeyYWRXFTKGNCQNKC-UHFFFAOYSA-N
MW223.25 g/mol
LogP1.82
Rot. Bonds1

About 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid

4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid (PubChem CID 83822997) has the molecular formula C10H9NO3S and a molecular weight of 223.25 g/mol. Its IUPAC name is 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid.

Molecular Properties

Compound Name4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid
PubChem CID83822997
Molecular FormulaC10H9NO3S
Molecular Weight223.25 g/mol
Exact Mass223.03
IUPAC Name4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid
SMILESO=C1CCSc2c(cccc2C(=O)O)N1
InChIInChI=1S/C10H9NO3S/c12-8-4-5-15-9-6(10(13)14)2-1-3-7(9)11-8/h1-3H,4-5H2,(H,11,12)(H,13,14)
InChIKeyYWRXFTKGNCQNKC-UHFFFAOYSA-N
XLogP1.82
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500223.25
LogP ≤ 51.82
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid?
The IUPAC name of 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid (CID 83822997) is 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid.
What is the SMILES notation for 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid?
The canonical SMILES for 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid is O=C1CCSc2c(cccc2C(=O)O)N1.
What is the InChIKey of 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid?
The InChIKey is YWRXFTKGNCQNKC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO3S/c12-8-4-5-15-9-6(10(13)14)2-1-3-7(9)11-8/h1-3H,4-5H2,(H,11,12)(H,13,14).
What are the key properties of 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid?
4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid has a molecular weight of 223.25 g/mol, XLogP of 1.82, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-3,5-dihydro-2H-1,5-benzothiazepine-9-carboxylic acid is sourced from PubChem (CID 83822997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).