2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid

C8H7NO2S — CID 164820283

IUPAC2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid
SMILESO=C(O)c1ccnc2c1SCC2
InChIInChI=1S/C8H7NO2S/c10-8(11)5-1-3-9-6-2-4-12-7(5)6/h1,3H,2,4H2,(H,10,11)
InChIKeyVWBYOTARUYGCHI-UHFFFAOYSA-N
MW181.22 g/mol
LogP1.43
Rot. Bonds1

About 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid

2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid (PubChem CID 164820283) has the molecular formula C8H7NO2S and a molecular weight of 181.22 g/mol. Its IUPAC name is 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid.

Molecular Properties

Compound Name2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid
PubChem CID164820283
Molecular FormulaC8H7NO2S
Molecular Weight181.22 g/mol
Exact Mass181.02
IUPAC Name2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid
SMILESO=C(O)c1ccnc2c1SCC2
InChIInChI=1S/C8H7NO2S/c10-8(11)5-1-3-9-6-2-4-12-7(5)6/h1,3H,2,4H2,(H,10,11)
InChIKeyVWBYOTARUYGCHI-UHFFFAOYSA-N
XLogP1.43
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.22
LogP ≤ 51.43
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid?
The IUPAC name of 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid (CID 164820283) is 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid.
What is the SMILES notation for 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid?
The canonical SMILES for 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid is O=C(O)c1ccnc2c1SCC2.
What is the InChIKey of 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid?
The InChIKey is VWBYOTARUYGCHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO2S/c10-8(11)5-1-3-9-6-2-4-12-7(5)6/h1,3H,2,4H2,(H,10,11).
What are the key properties of 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid?
2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid has a molecular weight of 181.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dihydrothieno[3,2-b]pyridine-7-carboxylic acid is sourced from PubChem (CID 164820283), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).