C24H23NO3S2 — CID 11510427
[(E)-[5-(4-methylphenyl)-3-thiophen-2-ylcyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 11510427) has the molecular formula C24H23NO3S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [(E)-[5-(4-methylphenyl)-3-thiophen-2-ylcyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[5-(4-methylphenyl)-3-thiophen-2-ylcyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 11510427 |
| Molecular Formula | C24H23NO3S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | [(E)-[5-(4-methylphenyl)-3-thiophen-2-ylcyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(C2CC(c3cccs3)=C/C(=N/OS(=O)(=O)c3ccc(C)cc3)C2)cc1 |
| InChI | InChI=1S/C24H23NO3S2/c1-17-5-9-19(10-6-17)20-14-21(24-4-3-13-29-24)16-22(15-20)25-28-30(26,27)23-11-7-18(2)8-12-23/h3-13,16,20H,14-15H2,1-2H3/b25-22+ |
| InChIKey | WMQNQXQLWYOVFE-YYDJUVGSSA-N |
| XLogP | 6.09 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|