C21H21NO3S2 — CID 145362674
[[6,7-bis(ethenyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 145362674) has the molecular formula C21H21NO3S2 and a molecular weight of 399.54 g/mol. Its IUPAC name is [[6,7-bis(ethenyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [[6,7-bis(ethenyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 145362674 |
| Molecular Formula | C21H21NO3S2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | [[6,7-bis(ethenyl)-2-methyl-2,3-dihydrothiochromen-4-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | C=Cc1cc2c(cc1C=C)C(=NOS(=O)(=O)c1ccc(C)cc1)CC(C)S2 |
| InChI | InChI=1S/C21H21NO3S2/c1-5-16-12-19-20(11-15(4)26-21(19)13-17(16)6-2)22-25-27(23,24)18-9-7-14(3)8-10-18/h5-10,12-13,15H,1-2,11H2,3-4H3 |
| InChIKey | XOPTVRDEOXFBMX-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|