C18H17NO3S — CID 87357979
[(E)-(4-ethenyl-2,3-dihydroinden-1-ylidene)amino] 4-methylbenzenesulfonate (PubChem CID 87357979) has the molecular formula C18H17NO3S and a molecular weight of 327.41 g/mol. Its IUPAC name is [(E)-(4-ethenyl-2,3-dihydroinden-1-ylidene)amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-(4-ethenyl-2,3-dihydroinden-1-ylidene)amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 87357979 |
| Molecular Formula | C18H17NO3S |
| Molecular Weight | 327.41 g/mol |
| Exact Mass | 327.09 |
| IUPAC Name | [(E)-(4-ethenyl-2,3-dihydroinden-1-ylidene)amino] 4-methylbenzenesulfonate |
| SMILES | C=Cc1cccc2c1CC/C2=N\OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H17NO3S/c1-3-14-5-4-6-17-16(14)11-12-18(17)19-22-23(20,21)15-9-7-13(2)8-10-15/h3-10H,1,11-12H2,2H3/b19-18+ |
| InChIKey | DEEMDSVTOPACRL-VHEBQXMUSA-N |
| XLogP | 3.69 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.41 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|