C15H17NO4S — CID 173099652
[(5-methoxy-2-methylcyclohexa-2,4-dien-1-ylidene)amino] 4-methylbenzenesulfonate (PubChem CID 173099652) has the molecular formula C15H17NO4S and a molecular weight of 307.37 g/mol. Its IUPAC name is [(5-methoxy-2-methylcyclohexa-2,4-dien-1-ylidene)amino] 4-methylbenzenesulfonate.
| Compound Name | [(5-methoxy-2-methylcyclohexa-2,4-dien-1-ylidene)amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 173099652 |
| Molecular Formula | C15H17NO4S |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | [(5-methoxy-2-methylcyclohexa-2,4-dien-1-ylidene)amino] 4-methylbenzenesulfonate |
| SMILES | COC1=CC=C(C)C(=NOS(=O)(=O)c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C15H17NO4S/c1-11-4-8-14(9-5-11)21(17,18)20-16-15-10-13(19-3)7-6-12(15)2/h4-9H,10H2,1-3H3 |
| InChIKey | RLOBUVSTJMWMOK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|