C22H34N4O4SSi — CID 10906933
[(E)-[(4R,5R)-5-azido-4-tri(propan-2-yl)silyloxycyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate (PubChem CID 10906933) has the molecular formula C22H34N4O4SSi and a molecular weight of 478.69 g/mol. Its IUPAC name is [(E)-[(4R,5R)-5-azido-4-tri(propan-2-yl)silyloxycyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate.
| Compound Name | [(E)-[(4R,5R)-5-azido-4-tri(propan-2-yl)silyloxycyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 10906933 |
| Molecular Formula | C22H34N4O4SSi |
| Molecular Weight | 478.69 g/mol |
| Exact Mass | 478.21 |
| IUPAC Name | [(E)-[(4R,5R)-5-azido-4-tri(propan-2-yl)silyloxycyclohex-2-en-1-ylidene]amino] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O/N=C2/C=C[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](N=[N+]=[N-])C2)cc1 |
| InChI | InChI=1S/C22H34N4O4SSi/c1-15(2)32(16(3)4,17(5)6)29-22-13-10-19(14-21(22)24-26-23)25-30-31(27,28)20-11-8-18(7)9-12-20/h8-13,15-17,21-22H,14H2,1-7H3/b25-19-/t21-,22-/m1/s1 |
| InChIKey | XZWOXHWZNCPKAQ-UIBBSPQCSA-N |
| XLogP | 6.26 |
| TPSA | 113.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|