C10H8ClFN2S — CID 115126969
1-N-(5-chlorothiophen-2-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 115126969) has the molecular formula C10H8ClFN2S and a molecular weight of 242.71 g/mol. Its IUPAC name is 1-N-(5-chlorothiophen-2-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(5-chlorothiophen-2-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 115126969 |
| Molecular Formula | C10H8ClFN2S |
| Molecular Weight | 242.71 g/mol |
| Exact Mass | 242.01 |
| IUPAC Name | 1-N-(5-chlorothiophen-2-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cccc1Nc1ccc(Cl)s1 |
| InChI | InChI=1S/C10H8ClFN2S/c11-8-4-5-9(15-8)14-7-3-1-2-6(12)10(7)13/h1-5,14H,13H2 |
| InChIKey | ZDGMZQCUJCHBQE-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.71 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|