C12H7Cl2FN4S — CID 65476001
1-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-3-fluorobenzene-1,2-diamine (PubChem CID 65476001) has the molecular formula C12H7Cl2FN4S and a molecular weight of 329.19 g/mol. Its IUPAC name is 1-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-3-fluorobenzene-1,2-diamine.
| Compound Name | 1-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-3-fluorobenzene-1,2-diamine |
|---|---|
| PubChem CID | 65476001 |
| Molecular Formula | C12H7Cl2FN4S |
| Molecular Weight | 329.19 g/mol |
| Exact Mass | 327.98 |
| IUPAC Name | 1-N-(5,7-dichloro-2,1,3-benzothiadiazol-4-yl)-3-fluorobenzene-1,2-diamine |
| SMILES | Nc1c(F)cccc1Nc1c(Cl)cc(Cl)c2nsnc12 |
| InChI | InChI=1S/C12H7Cl2FN4S/c13-5-4-6(14)11-12(19-20-18-11)10(5)17-8-3-1-2-7(15)9(8)16/h1-4,17H,16H2 |
| InChIKey | QDZCSRNFNRIVAH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.19 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|