C11H12F2N2O2 — CID 11514253
2-ethyl-5,5-difluoro-6,9-dihydropyrimido[1,6-a]azepine-1,3-dione (PubChem CID 11514253) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 2-ethyl-5,5-difluoro-6,9-dihydropyrimido[1,6-a]azepine-1,3-dione.
| Compound Name | 2-ethyl-5,5-difluoro-6,9-dihydropyrimido[1,6-a]azepine-1,3-dione |
|---|---|
| PubChem CID | 11514253 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 2-ethyl-5,5-difluoro-6,9-dihydropyrimido[1,6-a]azepine-1,3-dione |
| SMILES | CCn1c(=O)cc2n(c1=O)CC=CCC2(F)F |
| InChI | InChI=1S/C11H12F2N2O2/c1-2-14-9(16)7-8-11(12,13)5-3-4-6-15(8)10(14)17/h3-4,7H,2,5-6H2,1H3 |
| InChIKey | KTTOBHLWIDKSRX-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 44.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|