C13H16F2N2O2 — CID 11558085
6-(1,1-difluorobut-3-enyl)-3-ethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione (PubChem CID 11558085) has the molecular formula C13H16F2N2O2 and a molecular weight of 270.28 g/mol. Its IUPAC name is 6-(1,1-difluorobut-3-enyl)-3-ethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione.
| Compound Name | 6-(1,1-difluorobut-3-enyl)-3-ethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11558085 |
| Molecular Formula | C13H16F2N2O2 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | 6-(1,1-difluorobut-3-enyl)-3-ethyl-5-prop-2-enyl-1H-pyrimidine-2,4-dione |
| SMILES | C=CCc1c(C(F)(F)CC=C)[nH]c(=O)n(CC)c1=O |
| InChI | InChI=1S/C13H16F2N2O2/c1-4-7-9-10(13(14,15)8-5-2)16-12(19)17(6-3)11(9)18/h4-5H,1-2,6-8H2,3H3,(H,16,19) |
| InChIKey | GFHHKTYISZKURQ-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|