C11H12F2N2O2 — CID 11550487
3-ethyl-9,9-difluoro-5,8-dihydro-1H-cyclohepta[d]pyrimidine-2,4-dione (PubChem CID 11550487) has the molecular formula C11H12F2N2O2 and a molecular weight of 242.22 g/mol. Its IUPAC name is 3-ethyl-9,9-difluoro-5,8-dihydro-1H-cyclohepta[d]pyrimidine-2,4-dione.
| Compound Name | 3-ethyl-9,9-difluoro-5,8-dihydro-1H-cyclohepta[d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 11550487 |
| Molecular Formula | C11H12F2N2O2 |
| Molecular Weight | 242.22 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-ethyl-9,9-difluoro-5,8-dihydro-1H-cyclohepta[d]pyrimidine-2,4-dione |
| SMILES | CCn1c(=O)[nH]c2c(c1=O)CC=CCC2(F)F |
| InChI | InChI=1S/C11H12F2N2O2/c1-2-15-9(16)7-5-3-4-6-11(12,13)8(7)14-10(15)17/h3-4H,2,5-6H2,1H3,(H,14,17) |
| InChIKey | MYYLKBYRZKXFPT-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 54.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|