C22H30O6S — CID 11517425
dibutyl 4-(benzenesulfonyl)cyclohex-4-ene-1,2-dicarboxylate (PubChem CID 11517425) has the molecular formula C22H30O6S and a molecular weight of 422.54 g/mol. Its IUPAC name is dibutyl 4-(benzenesulfonyl)cyclohex-4-ene-1,2-dicarboxylate.
| Compound Name | dibutyl 4-(benzenesulfonyl)cyclohex-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11517425 |
| Molecular Formula | C22H30O6S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.18 |
| IUPAC Name | dibutyl 4-(benzenesulfonyl)cyclohex-4-ene-1,2-dicarboxylate |
| SMILES | CCCCOC(=O)C1CC=C(S(=O)(=O)c2ccccc2)CC1C(=O)OCCCC |
| InChI | InChI=1S/C22H30O6S/c1-3-5-14-27-21(23)19-13-12-18(16-20(19)22(24)28-15-6-4-2)29(25,26)17-10-8-7-9-11-17/h7-12,19-20H,3-6,13-16H2,1-2H3 |
| InChIKey | XPIPNTBWZRLIFX-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|