C8H9Cl2NO2 — CID 115228694
(3,5-dichloro-2-methoxyanilino)methanol (PubChem CID 115228694) has the molecular formula C8H9Cl2NO2 and a molecular weight of 222.07 g/mol. Its IUPAC name is (3,5-dichloro-2-methoxyanilino)methanol.
| Compound Name | (3,5-dichloro-2-methoxyanilino)methanol |
|---|---|
| PubChem CID | 115228694 |
| Molecular Formula | C8H9Cl2NO2 |
| Molecular Weight | 222.07 g/mol |
| Exact Mass | 221.00 |
| IUPAC Name | (3,5-dichloro-2-methoxyanilino)methanol |
| SMILES | COc1c(Cl)cc(Cl)cc1NCO |
| InChI | InChI=1S/C8H9Cl2NO2/c1-13-8-6(10)2-5(9)3-7(8)11-4-12/h2-3,11-12H,4H2,1H3 |
| InChIKey | SHVOBFIFROBZKM-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.07 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|