About 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile
3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile (PubChem CID 115230884) has the molecular formula C16H24N2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile.
Molecular Properties
| Compound Name | 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile |
| PubChem CID | 115230884 |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.19 |
| IUPAC Name | 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1CNCCC#N |
| InChI | InChI=1S/C16H24N2/c1-12-9-14(16(3,4)5)10-13(2)15(12)11-18-8-6-7-17/h9-10,18H,6,8,11H2,1-5H3 |
| InChIKey | BAWKKQISMWTTIG-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile?
The IUPAC name of 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile (CID 115230884) is 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile.
What is the SMILES notation for 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile?
The canonical SMILES for 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile is Cc1cc(C(C)(C)C)cc(C)c1CNCCC#N.
What is the InChIKey of 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile?
The InChIKey is BAWKKQISMWTTIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24N2/c1-12-9-14(16(3,4)5)10-13(2)15(12)11-18-8-6-7-17/h9-10,18H,6,8,11H2,1-5H3.
What are the key properties of 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile?
3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile has a molecular weight of 244.38 g/mol, XLogP of 3.60, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(4-tert-butyl-2,6-dimethylphenyl)methylamino]propanenitrile is sourced from PubChem (CID 115230884), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).