C14H16N2O2 — CID 115237209
(E)-4-[1H-indol-3-ylmethyl(methyl)amino]but-2-enoic acid (PubChem CID 115237209) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is (E)-4-[1H-indol-3-ylmethyl(methyl)amino]but-2-enoic acid.
| Compound Name | (E)-4-[1H-indol-3-ylmethyl(methyl)amino]but-2-enoic acid |
|---|---|
| PubChem CID | 115237209 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | (E)-4-[1H-indol-3-ylmethyl(methyl)amino]but-2-enoic acid |
| SMILES | CN(C/C=C/C(=O)O)Cc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C14H16N2O2/c1-16(8-4-7-14(17)18)10-11-9-15-13-6-3-2-5-12(11)13/h2-7,9,15H,8,10H2,1H3,(H,17,18)/b7-4+ |
| InChIKey | MABXLZDEHTYROX-QPJJXVBHSA-N |
| XLogP | 2.24 |
| TPSA | 56.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|