C16H20N2O4 — CID 175846616
(E)-but-2-enedioic acid;2-deuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine (PubChem CID 175846616) has the molecular formula C16H20N2O4 and a molecular weight of 305.35 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;2-deuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine.
| Compound Name | (E)-but-2-enedioic acid;2-deuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 175846616 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 305.35 g/mol |
| Exact Mass | 305.15 |
| IUPAC Name | (E)-but-2-enedioic acid;2-deuterio-2-(1H-indol-3-yl)-N,N-dimethylethanamine |
| SMILES | O=C(O)/C=C/C(=O)O.[2H]C(CN(C)C)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H16N2.C4H4O4/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12;5-3(6)1-2-4(7)8/h3-6,9,13H,7-8H2,1-2H3;1-2H,(H,5,6)(H,7,8)/b;2-1+/i7D; |
| InChIKey | OHMVTPSXVQQKPA-NULCCJATSA-N |
| XLogP | 1.98 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.35 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|