C16H15Br2NO2 — CID 11524434
N-[2-(2,2-dibromoethenyl)phenyl]-3,4-dimethoxyaniline (PubChem CID 11524434) has the molecular formula C16H15Br2NO2 and a molecular weight of 413.11 g/mol. Its IUPAC name is N-[2-(2,2-dibromoethenyl)phenyl]-3,4-dimethoxyaniline.
| Compound Name | N-[2-(2,2-dibromoethenyl)phenyl]-3,4-dimethoxyaniline |
|---|---|
| PubChem CID | 11524434 |
| Molecular Formula | C16H15Br2NO2 |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 410.95 |
| IUPAC Name | N-[2-(2,2-dibromoethenyl)phenyl]-3,4-dimethoxyaniline |
| SMILES | COc1ccc(Nc2ccccc2C=C(Br)Br)cc1OC |
| InChI | InChI=1S/C16H15Br2NO2/c1-20-14-8-7-12(10-15(14)21-2)19-13-6-4-3-5-11(13)9-16(17)18/h3-10,19H,1-2H3 |
| InChIKey | AGDBJIWCKVXHQS-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |