C17H22N2O4S — CID 11530403
tert-butyl 4,4-dimethyl-2,5-dioxo-3-(phenylsulfanylmethyl)imidazolidine-1-carboxylate (PubChem CID 11530403) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is tert-butyl 4,4-dimethyl-2,5-dioxo-3-(phenylsulfanylmethyl)imidazolidine-1-carboxylate.
| Compound Name | tert-butyl 4,4-dimethyl-2,5-dioxo-3-(phenylsulfanylmethyl)imidazolidine-1-carboxylate |
|---|---|
| PubChem CID | 11530403 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | tert-butyl 4,4-dimethyl-2,5-dioxo-3-(phenylsulfanylmethyl)imidazolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C(=O)N(CSc2ccccc2)C(C)(C)C1=O |
| InChI | InChI=1S/C17H22N2O4S/c1-16(2,3)23-15(22)19-13(20)17(4,5)18(14(19)21)11-24-12-9-7-6-8-10-12/h6-10H,11H2,1-5H3 |
| InChIKey | RORSACQJOUMQLH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|