C28H30BF4OP — CID 11533403
(5-hex-1-ynyloxolan-2-yl)-triphenylphosphanium tetrafluoroborate (PubChem CID 11533403) has the molecular formula C28H30BF4OP and a molecular weight of 500.33 g/mol. Its IUPAC name is (5-hex-1-ynyloxolan-2-yl)-triphenylphosphanium tetrafluoroborate.
| Compound Name | (5-hex-1-ynyloxolan-2-yl)-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 11533403 |
| Molecular Formula | C28H30BF4OP |
| Molecular Weight | 500.33 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | (5-hex-1-ynyloxolan-2-yl)-triphenylphosphanium tetrafluoroborate |
| SMILES | CCCCC#CC1CCC([P+](c2ccccc2)(c2ccccc2)c2ccccc2)O1.F[B-](F)(F)F |
| InChI | InChI=1S/C28H30OP.BF4/c1-2-3-4-8-15-24-22-23-28(29-24)30(25-16-9-5-10-17-25,26-18-11-6-12-19-26)27-20-13-7-14-21-27;2-1(3,4)5/h5-7,9-14,16-21,24,28H,2-4,22-23H2,1H3;/q+1;-1 |
| InChIKey | XVCZKBJENQKULM-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.33 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|