C17H20O — CID 100981830
(2S,6S)-6-hex-1-ynyl-2-phenyl-3,6-dihydro-2H-pyran (PubChem CID 100981830) has the molecular formula C17H20O and a molecular weight of 240.35 g/mol. Its IUPAC name is (2S,6S)-6-hex-1-ynyl-2-phenyl-3,6-dihydro-2H-pyran.
| Compound Name | (2S,6S)-6-hex-1-ynyl-2-phenyl-3,6-dihydro-2H-pyran |
|---|---|
| PubChem CID | 100981830 |
| Molecular Formula | C17H20O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (2S,6S)-6-hex-1-ynyl-2-phenyl-3,6-dihydro-2H-pyran |
| SMILES | CCCCC#C[C@@H]1C=CC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H20O/c1-2-3-4-8-12-16-13-9-14-17(18-16)15-10-6-5-7-11-15/h5-7,9-11,13,16-17H,2-4,14H2,1H3/t16-,17+/m1/s1 |
| InChIKey | XHEOVWRGPRNFCQ-SJORKVTESA-N |
| XLogP | 4.27 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|