C17H22O2 — CID 100981832
3,3-dimethyl-1-[(2S,6R)-2-phenyl-3,6-dihydro-2H-pyran-6-yl]butan-2-one (PubChem CID 100981832) has the molecular formula C17H22O2 and a molecular weight of 258.36 g/mol. Its IUPAC name is 3,3-dimethyl-1-[(2S,6R)-2-phenyl-3,6-dihydro-2H-pyran-6-yl]butan-2-one.
| Compound Name | 3,3-dimethyl-1-[(2S,6R)-2-phenyl-3,6-dihydro-2H-pyran-6-yl]butan-2-one |
|---|---|
| PubChem CID | 100981832 |
| Molecular Formula | C17H22O2 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 3,3-dimethyl-1-[(2S,6R)-2-phenyl-3,6-dihydro-2H-pyran-6-yl]butan-2-one |
| SMILES | CC(C)(C)C(=O)C[C@@H]1C=CC[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C17H22O2/c1-17(2,3)16(18)12-14-10-7-11-15(19-14)13-8-5-4-6-9-13/h4-10,14-15H,11-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | PTSUIZGTEZYLIN-GJZGRUSLSA-N |
| XLogP | 4.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|