C27H32BF4O4P — CID 90660915
[4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-triphenylphosphanium tetrafluoroborate (PubChem CID 90660915) has the molecular formula C27H32BF4O4P and a molecular weight of 538.33 g/mol. Its IUPAC name is [4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-triphenylphosphanium tetrafluoroborate.
| Compound Name | [4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-triphenylphosphanium tetrafluoroborate |
|---|---|
| PubChem CID | 90660915 |
| Molecular Formula | C27H32BF4O4P |
| Molecular Weight | 538.33 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | [4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-triphenylphosphanium tetrafluoroborate |
| SMILES | COCC1OC([P+](c2ccccc2)(c2ccccc2)c2ccccc2)CC(OC)C1OC.F[B-](F)(F)F |
| InChI | InChI=1S/C27H32O4P.BF4/c1-28-20-25-27(30-3)24(29-2)19-26(31-25)32(21-13-7-4-8-14-21,22-15-9-5-10-16-22)23-17-11-6-12-18-23;2-1(3,4)5/h4-18,24-27H,19-20H2,1-3H3;/q+1;-1 |
| InChIKey | GXISSVJBSGFSOY-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.33 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|