C16H27BrO5Si — CID 101261985
bromomethyl-[5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]furan-2-yl]-dimethylsilane (PubChem CID 101261985) has the molecular formula C16H27BrO5Si and a molecular weight of 407.38 g/mol. Its IUPAC name is bromomethyl-[5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]furan-2-yl]-dimethylsilane.
| Compound Name | bromomethyl-[5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]furan-2-yl]-dimethylsilane |
|---|---|
| PubChem CID | 101261985 |
| Molecular Formula | C16H27BrO5Si |
| Molecular Weight | 407.38 g/mol |
| Exact Mass | 406.08 |
| IUPAC Name | bromomethyl-[5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]furan-2-yl]-dimethylsilane |
| SMILES | COC[C@H]1O[C@@H](c2ccc([Si](C)(C)CBr)o2)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C16H27BrO5Si/c1-18-9-14-16(20-3)13(19-2)8-12(21-14)11-6-7-15(22-11)23(4,5)10-17/h6-7,12-14,16H,8-10H2,1-5H3/t12-,13-,14-,16+/m1/s1 |
| InChIKey | NJLGBALDRSGXAG-KQTLUZQSSA-N |
| XLogP | 2.64 |
| TPSA | 50.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.38 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|