C27H26O7 — CID 72711768
5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-6-hydroxybenzo[a]anthracene-7,12-dione (PubChem CID 72711768) has the molecular formula C27H26O7 and a molecular weight of 462.50 g/mol. Its IUPAC name is 5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-6-hydroxybenzo[a]anthracene-7,12-dione.
| Compound Name | 5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-6-hydroxybenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 72711768 |
| Molecular Formula | C27H26O7 |
| Molecular Weight | 462.50 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 5-[(2R,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]-6-hydroxybenzo[a]anthracene-7,12-dione |
| SMILES | COC[C@H]1O[C@@H](c2c(O)c3c(c4ccccc24)C(=O)c2ccccc2C3=O)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C27H26O7/c1-31-13-20-27(33-3)19(32-2)12-18(34-20)21-14-8-4-5-9-15(14)22-23(26(21)30)25(29)17-11-7-6-10-16(17)24(22)28/h4-11,18-20,27,30H,12-13H2,1-3H3/t18-,19-,20-,27+/m1/s1 |
| InChIKey | OQSSKXXIYNKZJE-SWOWEMQBSA-N |
| XLogP | 3.83 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.50 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|