C22H34O4 — CID 171823736
ethane;3-methoxy-2-(methoxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolane (PubChem CID 171823736) has the molecular formula C22H34O4 and a molecular weight of 362.51 g/mol. Its IUPAC name is ethane;3-methoxy-2-(methoxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolane.
| Compound Name | ethane;3-methoxy-2-(methoxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolane |
|---|---|
| PubChem CID | 171823736 |
| Molecular Formula | C22H34O4 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.25 |
| IUPAC Name | ethane;3-methoxy-2-(methoxymethyl)-5-(3-methoxynaphthalen-2-yl)oxolane |
| SMILES | CC.CC.COCC1OC(c2cc3ccccc3cc2OC)CC1OC |
| InChI | InChI=1S/C18H22O4.2C2H6/c1-19-11-18-17(21-3)10-16(22-18)14-8-12-6-4-5-7-13(12)9-15(14)20-2;2*1-2/h4-9,16-18H,10-11H2,1-3H3;2*1-2H3 |
| InChIKey | IKWSTHVSCSTEOD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |