C32H24O6 — CID 122385836
1,4-dihydroxy-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]-3-(4-phenyloxetan-2-yl)anthracene-9,10-dione (PubChem CID 122385836) has the molecular formula C32H24O6 and a molecular weight of 504.54 g/mol. Its IUPAC name is 1,4-dihydroxy-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]-3-(4-phenyloxetan-2-yl)anthracene-9,10-dione.
| Compound Name | 1,4-dihydroxy-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]-3-(4-phenyloxetan-2-yl)anthracene-9,10-dione |
|---|---|
| PubChem CID | 122385836 |
| Molecular Formula | C32H24O6 |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | 1,4-dihydroxy-2-[(E)-1-hydroxy-3-phenylprop-2-enyl]-3-(4-phenyloxetan-2-yl)anthracene-9,10-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c(O)c(C3CC(c4ccccc4)O3)c(C(O)/C=C/c3ccccc3)c(O)c21 |
| InChI | InChI=1S/C32H24O6/c33-22(16-15-18-9-3-1-4-10-18)25-26(24-17-23(38-24)19-11-5-2-6-12-19)32(37)28-27(31(25)36)29(34)20-13-7-8-14-21(20)30(28)35/h1-16,22-24,33,36-37H,17H2/b16-15+ |
| InChIKey | FZLDENJFOBUMGD-FOCLMDBBSA-N |
| XLogP | 5.82 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|