C14H14O2 — CID 46193327
2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-one (PubChem CID 46193327) has the molecular formula C14H14O2 and a molecular weight of 214.26 g/mol. Its IUPAC name is 2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-one.
| Compound Name | 2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-one |
|---|---|
| PubChem CID | 46193327 |
| Molecular Formula | C14H14O2 |
| Molecular Weight | 214.26 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-[(E,1S)-1-hydroxy-3-phenylprop-2-enyl]cyclopent-2-en-1-one |
| SMILES | O=C1CCC=C1[C@@H](O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C14H14O2/c15-13-8-4-7-12(13)14(16)10-9-11-5-2-1-3-6-11/h1-3,5-7,9-10,14,16H,4,8H2/b10-9+/t14-/m0/s1 |
| InChIKey | VKFUEIDBHYCHEM-HBWSCVEGSA-N |
| XLogP | 2.35 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |