C21H28O8 — CID 101122805
9-[(2S,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,6-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene (PubChem CID 101122805) has the molecular formula C21H28O8 and a molecular weight of 408.45 g/mol. Its IUPAC name is 9-[(2S,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,6-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene.
| Compound Name | 9-[(2S,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,6-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
|---|---|
| PubChem CID | 101122805 |
| Molecular Formula | C21H28O8 |
| Molecular Weight | 408.45 g/mol |
| Exact Mass | 408.18 |
| IUPAC Name | 9-[(2S,4R,5S,6R)-4,5-dimethoxy-6-(methoxymethyl)oxan-2-yl]oxy-3,6-dimethoxy-11-oxatricyclo[6.2.1.02,7]undeca-2,4,6,9-tetraene |
| SMILES | COC[C@H]1O[C@@H](OC2=CC3OC2c2c(OC)ccc(OC)c23)C[C@@H](OC)[C@@H]1OC |
| InChI | InChI=1S/C21H28O8/c1-22-10-16-20(26-5)14(25-4)9-17(28-16)27-15-8-13-18-11(23-2)6-7-12(24-3)19(18)21(15)29-13/h6-8,13-14,16-17,20-21H,9-10H2,1-5H3/t13?,14-,16-,17-,20+,21?/m1/s1 |
| InChIKey | YWDAQYOFVUNASS-LZHMRQMCSA-N |
| XLogP | 2.52 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.45 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |