C14H18N2O3S — CID 115344693
(E)-3-(3-aminophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]prop-2-enamide (PubChem CID 115344693) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is (E)-3-(3-aminophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-(3-aminophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 115344693 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | (E)-3-(3-aminophenyl)-N-[(1,1-dioxothiolan-2-yl)methyl]prop-2-enamide |
| SMILES | Nc1cccc(/C=C/C(=O)NCC2CCCS2(=O)=O)c1 |
| InChI | InChI=1S/C14H18N2O3S/c15-12-4-1-3-11(9-12)6-7-14(17)16-10-13-5-2-8-20(13,18)19/h1,3-4,6-7,9,13H,2,5,8,10,15H2,(H,16,17)/b7-6+ |
| InChIKey | YLPUKHLKNSTCMF-VOTSOKGWSA-N |
| XLogP | 0.98 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|