C9H16N2O3 — CID 115370969
1-(1,4-dioxan-2-ylmethyl)-1,3-diazinan-2-one (PubChem CID 115370969) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 1-(1,4-dioxan-2-ylmethyl)-1,3-diazinan-2-one.
| Compound Name | 1-(1,4-dioxan-2-ylmethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 115370969 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 1-(1,4-dioxan-2-ylmethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NCCCN1CC1COCCO1 |
| InChI | InChI=1S/C9H16N2O3/c12-9-10-2-1-3-11(9)6-8-7-13-4-5-14-8/h8H,1-7H2,(H,10,12) |
| InChIKey | WBDYUEGVOZKICQ-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |