C21H24FNO2 — CID 11537429
9-tert-butyl-5-(2-fluorophenyl)-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinoline (PubChem CID 11537429) has the molecular formula C21H24FNO2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 9-tert-butyl-5-(2-fluorophenyl)-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinoline.
| Compound Name | 9-tert-butyl-5-(2-fluorophenyl)-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinoline |
|---|---|
| PubChem CID | 11537429 |
| Molecular Formula | C21H24FNO2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | 9-tert-butyl-5-(2-fluorophenyl)-2,3,4a,5,6,10b-hexahydro-[1,4]dioxino[2,3-c]quinoline |
| SMILES | CC(C)(C)c1ccc2c(c1)C1OCCOC1C(c1ccccc1F)N2 |
| InChI | InChI=1S/C21H24FNO2/c1-21(2,3)13-8-9-17-15(12-13)19-20(25-11-10-24-19)18(23-17)14-6-4-5-7-16(14)22/h4-9,12,18-20,23H,10-11H2,1-3H3 |
| InChIKey | FIJBBZPPJOUKTE-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |