C11H20N2S2 — CID 115388967
(3-methyl-1,4-dithian-2-yl)-piperidin-1-ylmethanimine (PubChem CID 115388967) has the molecular formula C11H20N2S2 and a molecular weight of 244.43 g/mol. Its IUPAC name is (3-methyl-1,4-dithian-2-yl)-piperidin-1-ylmethanimine.
| Compound Name | (3-methyl-1,4-dithian-2-yl)-piperidin-1-ylmethanimine |
|---|---|
| PubChem CID | 115388967 |
| Molecular Formula | C11H20N2S2 |
| Molecular Weight | 244.43 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | (3-methyl-1,4-dithian-2-yl)-piperidin-1-ylmethanimine |
| SMILES | [H]/N=C(/C1SCCSC1C)N1CCCCC1 |
| InChI | InChI=1S/C11H20N2S2/c1-9-10(15-8-7-14-9)11(12)13-5-3-2-4-6-13/h9-10,12H,2-8H2,1H3/b12-11- |
| InChIKey | CADPECXUKSNTQD-QXMHVHEDSA-N |
| XLogP | 2.69 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.43 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|