C10H6FN3S — CID 115404517
2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1,3-thiazole (PubChem CID 115404517) has the molecular formula C10H6FN3S and a molecular weight of 219.24 g/mol. Its IUPAC name is 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1,3-thiazole.
| Compound Name | 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 115404517 |
| Molecular Formula | C10H6FN3S |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.03 |
| IUPAC Name | 2-(6-fluoroimidazo[1,2-a]pyridin-2-yl)-1,3-thiazole |
| SMILES | Fc1ccc2nc(-c3nccs3)cn2c1 |
| InChI | InChI=1S/C10H6FN3S/c11-7-1-2-9-13-8(6-14(9)5-7)10-12-3-4-15-10/h1-6H |
| InChIKey | BQLPMFSDZYSZOS-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |