C7H12F2N2OS — CID 115407186
3-amino-N-(2,2-difluoroethyl)-2,2-dimethyl-3-sulfanylidenepropanamide (PubChem CID 115407186) has the molecular formula C7H12F2N2OS and a molecular weight of 210.25 g/mol. Its IUPAC name is 3-amino-N-(2,2-difluoroethyl)-2,2-dimethyl-3-sulfanylidenepropanamide.
| Compound Name | 3-amino-N-(2,2-difluoroethyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
|---|---|
| PubChem CID | 115407186 |
| Molecular Formula | C7H12F2N2OS |
| Molecular Weight | 210.25 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | 3-amino-N-(2,2-difluoroethyl)-2,2-dimethyl-3-sulfanylidenepropanamide |
| SMILES | CC(C)(C(=O)NCC(F)F)C(N)=S |
| InChI | InChI=1S/C7H12F2N2OS/c1-7(2,5(10)13)6(12)11-3-4(8)9/h4H,3H2,1-2H3,(H2,10,13)(H,11,12) |
| InChIKey | FHGSMTPHZMLNHM-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.25 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|