C12H22F2N4O2S — CID 115409299
N-(2,2-difluoroethyl)-1-[3-(ethylamino)propyl]-3,5-dimethylpyrazole-4-sulfonamide (PubChem CID 115409299) has the molecular formula C12H22F2N4O2S and a molecular weight of 324.40 g/mol. Its IUPAC name is N-(2,2-difluoroethyl)-1-[3-(ethylamino)propyl]-3,5-dimethylpyrazole-4-sulfonamide.
| Compound Name | N-(2,2-difluoroethyl)-1-[3-(ethylamino)propyl]-3,5-dimethylpyrazole-4-sulfonamide |
|---|---|
| PubChem CID | 115409299 |
| Molecular Formula | C12H22F2N4O2S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | N-(2,2-difluoroethyl)-1-[3-(ethylamino)propyl]-3,5-dimethylpyrazole-4-sulfonamide |
| SMILES | CCNCCCn1nc(C)c(S(=O)(=O)NCC(F)F)c1C |
| InChI | InChI=1S/C12H22F2N4O2S/c1-4-15-6-5-7-18-10(3)12(9(2)17-18)21(19,20)16-8-11(13)14/h11,15-16H,4-8H2,1-3H3 |
| InChIKey | VMSUWYXQPIBMND-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|