C13H20N2O5 — CID 11543758
propyl 3-ethoxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoate (PubChem CID 11543758) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is propyl 3-ethoxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoate.
| Compound Name | propyl 3-ethoxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoate |
|---|---|
| PubChem CID | 11543758 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | propyl 3-ethoxy-3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanoate |
| SMILES | CCCOC(=O)CC(OCC)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H20N2O5/c1-4-6-20-11(16)7-10(19-5-2)15-8-9(3)12(17)14-13(15)18/h8,10H,4-7H2,1-3H3,(H,14,17,18) |
| InChIKey | DYAXNGYANXRCEE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |