C14H25N3O5P+ — CID 166821516
dimethylamino-[(2S)-2-[(1R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propoxy]butoxy]-oxophosphanium (PubChem CID 166821516) has the molecular formula C14H25N3O5P+ and a molecular weight of 346.34 g/mol. Its IUPAC name is dimethylamino-[(2S)-2-[(1R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propoxy]butoxy]-oxophosphanium.
| Compound Name | dimethylamino-[(2S)-2-[(1R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propoxy]butoxy]-oxophosphanium |
|---|---|
| PubChem CID | 166821516 |
| Molecular Formula | C14H25N3O5P+ |
| Molecular Weight | 346.34 g/mol |
| Exact Mass | 346.15 |
| IUPAC Name | dimethylamino-[(2S)-2-[(1R)-1-(5-methyl-2,4-dioxopyrimidin-1-yl)propoxy]butoxy]-oxophosphanium |
| SMILES | CC[C@@H](CO[P+](=O)N(C)C)O[C@H](CC)n1cc(C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H24N3O5P/c1-6-11(9-21-23(20)16(4)5)22-12(7-2)17-8-10(3)13(18)15-14(17)19/h8,11-12H,6-7,9H2,1-5H3/p+1/t11-,12+/m0/s1 |
| InChIKey | AXKMQMVAYBIERU-NWDGAFQWSA-O |
| XLogP | 1.78 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|