C10H17N2NaO8P — CID 6331237
CID 6331237 (PubChem CID 6331237) has the molecular formula C10H17N2NaO8P and a molecular weight of 347.22 g/mol.
| Compound Name | CID 6331237 |
|---|---|
| PubChem CID | 6331237 |
| Molecular Formula | C10H17N2NaO8P |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | — |
| SMILES | Cc1cn(C(CO)OC(CO)CP(=O)(O)O)c(=O)[nH]c1=O.[Na] |
| InChI | InChI=1S/C10H17N2O8P.Na/c1-6-2-12(10(16)11-9(6)15)8(4-14)20-7(3-13)5-21(17,18)19;/h2,7-8,13-14H,3-5H2,1H3,(H,11,15,16)(H2,17,18,19); |
| InChIKey | LIGPTCUIIQGSAT-UHFFFAOYSA-N |
| XLogP | -2.49 |
| TPSA | 162.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | -2.49 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|