C14H25N2O6P — CID 176853308
[(2S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxypropoxy]-propan-2-ylphosphinic acid (PubChem CID 176853308) has the molecular formula C14H25N2O6P and a molecular weight of 348.34 g/mol. Its IUPAC name is [(2S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxypropoxy]-propan-2-ylphosphinic acid.
| Compound Name | [(2S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxypropoxy]-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 176853308 |
| Molecular Formula | C14H25N2O6P |
| Molecular Weight | 348.34 g/mol |
| Exact Mass | 348.15 |
| IUPAC Name | [(2S)-2-(5-methyl-2,4-dioxopyrimidin-1-yl)-3-propan-2-yloxypropoxy]-propan-2-ylphosphinic acid |
| SMILES | Cc1cn([C@@H](COC(C)C)COP(=O)(O)C(C)C)c(=O)[nH]c1=O |
| InChI | InChI=1S/C14H25N2O6P/c1-9(2)21-7-12(8-22-23(19,20)10(3)4)16-6-11(5)13(17)15-14(16)18/h6,9-10,12H,7-8H2,1-5H3,(H,19,20)(H,15,17,18)/t12-/m0/s1 |
| InChIKey | NRZOUSSHYJPFOH-LBPRGKRZSA-N |
| XLogP | 1.42 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.34 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|