C13H9BrN2O — CID 115467528
12-bromo-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene (PubChem CID 115467528) has the molecular formula C13H9BrN2O and a molecular weight of 289.13 g/mol. Its IUPAC name is 12-bromo-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene.
| Compound Name | 12-bromo-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
|---|---|
| PubChem CID | 115467528 |
| Molecular Formula | C13H9BrN2O |
| Molecular Weight | 289.13 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | 12-bromo-5-oxa-10,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(9),2(6),3,11,13,15-hexaene |
| SMILES | Brc1ccc2nc3c(n2c1)CCc1occc1-3 |
| InChI | InChI=1S/C13H9BrN2O/c14-8-1-4-12-15-13-9-5-6-17-11(9)3-2-10(13)16(12)7-8/h1,4-7H,2-3H2 |
| InChIKey | LHJDWZRWTSRCOK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 30.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.13 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |