C20H25F2NO — CID 11551716
1-[[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-fluoro-4-(5-fluoro-2-methoxyphenyl)piperidine (PubChem CID 11551716) has the molecular formula C20H25F2NO and a molecular weight of 333.42 g/mol. Its IUPAC name is 1-[[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-fluoro-4-(5-fluoro-2-methoxyphenyl)piperidine.
| Compound Name | 1-[[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-fluoro-4-(5-fluoro-2-methoxyphenyl)piperidine |
|---|---|
| PubChem CID | 11551716 |
| Molecular Formula | C20H25F2NO |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | 1-[[(2S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-fluoro-4-(5-fluoro-2-methoxyphenyl)piperidine |
| SMILES | COc1ccc(F)cc1C1(F)CCN(C[C@H]2CC3C=CC2C3)CC1 |
| InChI | InChI=1S/C20H25F2NO/c1-24-19-5-4-17(21)12-18(19)20(22)6-8-23(9-7-20)13-16-11-14-2-3-15(16)10-14/h2-5,12,14-16H,6-11,13H2,1H3/t14?,15?,16-/m1/s1 |
| InChIKey | YFPDPEKHORBAFC-UYSNPLJNSA-N |
| XLogP | 4.31 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|