C22H29N2O+ — CID 123563979
1'-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,2-dimethylspiro[indol-1-ium-3,4'-piperidine] 1-oxide (PubChem CID 123563979) has the molecular formula C22H29N2O+ and a molecular weight of 337.49 g/mol. Its IUPAC name is 1'-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,2-dimethylspiro[indol-1-ium-3,4'-piperidine] 1-oxide.
| Compound Name | 1'-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,2-dimethylspiro[indol-1-ium-3,4'-piperidine] 1-oxide |
|---|---|
| PubChem CID | 123563979 |
| Molecular Formula | C22H29N2O+ |
| Molecular Weight | 337.49 g/mol |
| Exact Mass | 337.23 |
| IUPAC Name | 1'-[[(1S,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-2,2-dimethylspiro[indol-1-ium-3,4'-piperidine] 1-oxide |
| SMILES | CC1(C)[N+](=O)c2ccccc2C12CCN(C[C@H]1C[C@@H]3C=C[C@@H]1C3)CC2 |
| InChI | InChI=1S/C22H29N2O/c1-21(2)22(19-5-3-4-6-20(19)24(21)25)9-11-23(12-10-22)15-18-14-16-7-8-17(18)13-16/h3-8,16-18H,9-15H2,1-2H3/q+1/t16-,17-,18-/m1/s1 |
| InChIKey | QBILXWUWBJTTND-KZNAEPCWSA-N |
| XLogP | 4.43 |
| TPSA | 23.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.49 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|