C20H22ClNO2 — CID 158320461
1'-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one (PubChem CID 158320461) has the molecular formula C20H22ClNO2 and a molecular weight of 343.85 g/mol. Its IUPAC name is 1'-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one.
| Compound Name | 1'-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one |
|---|---|
| PubChem CID | 158320461 |
| Molecular Formula | C20H22ClNO2 |
| Molecular Weight | 343.85 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | 1'-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-6-chlorospiro[2-benzofuran-3,4'-piperidine]-1-one |
| SMILES | O=C1OC2(CCN(C[C@H]3C[C@H]4C=C[C@H]3C4)CC2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C20H22ClNO2/c21-16-3-4-18-17(11-16)19(23)24-20(18)5-7-22(8-6-20)12-15-10-13-1-2-14(15)9-13/h1-4,11,13-15H,5-10,12H2/t13-,14-,15+/m0/s1 |
| InChIKey | GOTYWGOUGOXPSO-SOUVJXGZSA-N |
| XLogP | 4.01 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.85 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|