C19H24BrNO — CID 124525512
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-bromophenyl)piperidin-4-ol (PubChem CID 124525512) has the molecular formula C19H24BrNO and a molecular weight of 362.31 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-bromophenyl)piperidin-4-ol.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-bromophenyl)piperidin-4-ol |
|---|---|
| PubChem CID | 124525512 |
| Molecular Formula | C19H24BrNO |
| Molecular Weight | 362.31 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(4-bromophenyl)piperidin-4-ol |
| SMILES | OC1(c2ccc(Br)cc2)CCN(C[C@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C19H24BrNO/c20-18-5-3-17(4-6-18)19(22)7-9-21(10-8-19)13-16-12-14-1-2-15(16)11-14/h1-6,14-16,22H,7-13H2/t14-,15-,16+/m0/s1 |
| InChIKey | OANXVWJLWGHWKX-HRCADAONSA-N |
| XLogP | 3.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.31 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|