C21H28FNO2 — CID 58772440
1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(5-fluoro-2-methoxyphenyl)-4-methoxypiperidine (PubChem CID 58772440) has the molecular formula C21H28FNO2 and a molecular weight of 345.46 g/mol. Its IUPAC name is 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(5-fluoro-2-methoxyphenyl)-4-methoxypiperidine.
| Compound Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(5-fluoro-2-methoxyphenyl)-4-methoxypiperidine |
|---|---|
| PubChem CID | 58772440 |
| Molecular Formula | C21H28FNO2 |
| Molecular Weight | 345.46 g/mol |
| Exact Mass | 345.21 |
| IUPAC Name | 1-[[(1R,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-4-(5-fluoro-2-methoxyphenyl)-4-methoxypiperidine |
| SMILES | COc1ccc(F)cc1C1(OC)CCN(C[C@H]2C[C@H]3C=C[C@H]2C3)CC1 |
| InChI | InChI=1S/C21H28FNO2/c1-24-20-6-5-18(22)13-19(20)21(25-2)7-9-23(10-8-21)14-17-12-15-3-4-16(17)11-15/h3-6,13,15-17H,7-12,14H2,1-2H3/t15-,16-,17+/m0/s1 |
| InChIKey | CEPHXHKHXPFMKS-YESZJQIVSA-N |
| XLogP | 3.98 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.46 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|