C26H44O4Si — CID 11554177
(1R,4aR,4bS,8aR,10aS)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(methoxymethoxy)-2,4b-dimethyl-1,4,4a,5,6,8a,10,10a-octahydrophenanthren-9-one (PubChem CID 11554177) has the molecular formula C26H44O4Si and a molecular weight of 448.72 g/mol. Its IUPAC name is (1R,4aR,4bS,8aR,10aS)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(methoxymethoxy)-2,4b-dimethyl-1,4,4a,5,6,8a,10,10a-octahydrophenanthren-9-one.
| Compound Name | (1R,4aR,4bS,8aR,10aS)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(methoxymethoxy)-2,4b-dimethyl-1,4,4a,5,6,8a,10,10a-octahydrophenanthren-9-one |
|---|---|
| PubChem CID | 11554177 |
| Molecular Formula | C26H44O4Si |
| Molecular Weight | 448.72 g/mol |
| Exact Mass | 448.30 |
| IUPAC Name | (1R,4aR,4bS,8aR,10aS)-8-[2-[tert-butyl(dimethyl)silyl]oxyethyl]-1-(methoxymethoxy)-2,4b-dimethyl-1,4,4a,5,6,8a,10,10a-octahydrophenanthren-9-one |
| SMILES | COCO[C@H]1C(C)=CC[C@@H]2[C@@H]1CC(=O)[C@@H]1C(CCO[Si](C)(C)C(C)(C)C)=CCC[C@]12C |
| InChI | InChI=1S/C26H44O4Si/c1-18-11-12-21-20(24(18)29-17-28-6)16-22(27)23-19(10-9-14-26(21,23)5)13-15-30-31(7,8)25(2,3)4/h10-11,20-21,23-24H,9,12-17H2,1-8H3/t20-,21+,23-,24-,26-/m0/s1 |
| InChIKey | DAMKWLNALNDHDI-BCVFTJSSSA-N |
| XLogP | 6.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.72 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|